C11H17F2N — CID 146580822
(2Z,4E)-6,6-difluoro-5-methyl-2-propan-2-ylhepta-2,4-dien-1-imine (PubChem CID 146580822) has the molecular formula C11H17F2N and a molecular weight of 201.26 g/mol. Its IUPAC name is (2Z,4E)-6,6-difluoro-5-methyl-2-propan-2-ylhepta-2,4-dien-1-imine.
| Compound Name | (2Z,4E)-6,6-difluoro-5-methyl-2-propan-2-ylhepta-2,4-dien-1-imine |
|---|---|
| PubChem CID | 146580822 |
| Molecular Formula | C11H17F2N |
| Molecular Weight | 201.26 g/mol |
| Exact Mass | 201.13 |
| IUPAC Name | (2Z,4E)-6,6-difluoro-5-methyl-2-propan-2-ylhepta-2,4-dien-1-imine |
| SMILES | [H]/N=C/C(=C\C=C(/C)C(C)(F)F)C(C)C |
| InChI | InChI=1S/C11H17F2N/c1-8(2)10(7-14)6-5-9(3)11(4,12)13/h5-8,14H,1-4H3/b9-5+,10-6+,14-7+ |
| InChIKey | KAEQOFBNQKHGSD-JPDLCMCMSA-N |
| XLogP | 3.82 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.26 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|