C26H21F4N3O3 — CID 146580985
2-methyl-6-[2,3,5,6-tetrafluoro-4-[4-(morpholin-4-ylmethyl)phenyl]phenyl]-1H-benzimidazole-4-carboxylic acid (PubChem CID 146580985) has the molecular formula C26H21F4N3O3 and a molecular weight of 499.46 g/mol. Its IUPAC name is 2-methyl-6-[2,3,5,6-tetrafluoro-4-[4-(morpholin-4-ylmethyl)phenyl]phenyl]-1H-benzimidazole-4-carboxylic acid.
| Compound Name | 2-methyl-6-[2,3,5,6-tetrafluoro-4-[4-(morpholin-4-ylmethyl)phenyl]phenyl]-1H-benzimidazole-4-carboxylic acid |
|---|---|
| PubChem CID | 146580985 |
| Molecular Formula | C26H21F4N3O3 |
| Molecular Weight | 499.46 g/mol |
| Exact Mass | 499.15 |
| IUPAC Name | 2-methyl-6-[2,3,5,6-tetrafluoro-4-[4-(morpholin-4-ylmethyl)phenyl]phenyl]-1H-benzimidazole-4-carboxylic acid |
| SMILES | Cc1nc2c(C(=O)O)cc(-c3c(F)c(F)c(-c4ccc(CN5CCOCC5)cc4)c(F)c3F)cc2[nH]1 |
| InChI | InChI=1S/C26H21F4N3O3/c1-13-31-18-11-16(10-17(26(34)35)25(18)32-13)20-23(29)21(27)19(22(28)24(20)30)15-4-2-14(3-5-15)12-33-6-8-36-9-7-33/h2-5,10-11H,6-9,12H2,1H3,(H,31,32)(H,34,35) |
| InChIKey | FTGQXQKIHZBOQK-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 78.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.46 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|