About N-(1,3-dihydropyrrol-2-ylidene)-N'-[1-[1-[(2S)-pentan-2-yl]pyrazol-4-yl]ethyl]methanimidamide
N-(1,3-dihydropyrrol-2-ylidene)-N'-[1-[1-[(2S)-pentan-2-yl]pyrazol-4-yl]ethyl]methanimidamide (PubChem CID 146581139) has the molecular formula C15H23N5
and a molecular weight of 273.38 g/mol. Its IUPAC name is N-(1,3-dihydropyrrol-2-ylidene)-N'-[1-[1-[(2S)-pentan-2-yl]pyrazol-4-yl]ethyl]methanimidamide.
Molecular Properties
| Compound Name | N-(1,3-dihydropyrrol-2-ylidene)-N'-[1-[1-[(2S)-pentan-2-yl]pyrazol-4-yl]ethyl]methanimidamide |
| PubChem CID | 146581139 |
| Molecular Formula | C15H23N5 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.20 |
| IUPAC Name | N-(1,3-dihydropyrrol-2-ylidene)-N'-[1-[1-[(2S)-pentan-2-yl]pyrazol-4-yl]ethyl]methanimidamide |
| SMILES | CCC[C@H](C)n1cc(C(C)/N=C/N=C2\CC=CN2)cn1 |
| InChI | InChI=1S/C15H23N5/c1-4-6-12(2)20-10-14(9-19-20)13(3)17-11-18-15-7-5-8-16-15/h5,8-13H,4,6-7H2,1-3H3,(H,16,17,18)/t12-,13?/m0/s1 |
| InChIKey | FNHLHPDVYVGQRN-UEWDXFNNSA-N |
| XLogP | 3.24 |
| TPSA | 54.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-(1,3-dihydropyrrol-2-ylidene)-N'-[1-[1-[(2S)-pentan-2-yl]pyrazol-4-yl]ethyl]methanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1,3-dihydropyrrol-2-ylidene)-N'-[1-[1-[(2S)-pentan-2-yl]pyrazol-4-yl]ethyl]methanimidamide?
The IUPAC name of N-(1,3-dihydropyrrol-2-ylidene)-N'-[1-[1-[(2S)-pentan-2-yl]pyrazol-4-yl]ethyl]methanimidamide (CID 146581139) is N-(1,3-dihydropyrrol-2-ylidene)-N'-[1-[1-[(2S)-pentan-2-yl]pyrazol-4-yl]ethyl]methanimidamide.
What is the SMILES notation for N-(1,3-dihydropyrrol-2-ylidene)-N'-[1-[1-[(2S)-pentan-2-yl]pyrazol-4-yl]ethyl]methanimidamide?
The canonical SMILES for N-(1,3-dihydropyrrol-2-ylidene)-N'-[1-[1-[(2S)-pentan-2-yl]pyrazol-4-yl]ethyl]methanimidamide is CCC[C@H](C)n1cc(C(C)/N=C/N=C2\CC=CN2)cn1.
What is the InChIKey of N-(1,3-dihydropyrrol-2-ylidene)-N'-[1-[1-[(2S)-pentan-2-yl]pyrazol-4-yl]ethyl]methanimidamide?
The InChIKey is FNHLHPDVYVGQRN-UEWDXFNNSA-N. The full InChI is InChI=1S/C15H23N5/c1-4-6-12(2)20-10-14(9-19-20)13(3)17-11-18-15-7-5-8-16-15/h5,8-13H,4,6-7H2,1-3H3,(H,16,17,18)/t12-,13?/m0/s1.
What are the key properties of N-(1,3-dihydropyrrol-2-ylidene)-N'-[1-[1-[(2S)-pentan-2-yl]pyrazol-4-yl]ethyl]methanimidamide?
N-(1,3-dihydropyrrol-2-ylidene)-N'-[1-[1-[(2S)-pentan-2-yl]pyrazol-4-yl]ethyl]methanimidamide has a molecular weight of 273.38 g/mol, XLogP of 3.24, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1,3-dihydropyrrol-2-ylidene)-N'-[1-[1-[(2S)-pentan-2-yl]pyrazol-4-yl]ethyl]methanimidamide is sourced from PubChem (CID 146581139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).