About 6-(2,3-dimethylbutyl)-3,4-dimethyl-4H-oxazine
6-(2,3-dimethylbutyl)-3,4-dimethyl-4H-oxazine (PubChem CID 146581273) has the molecular formula C12H21NO
and a molecular weight of 195.31 g/mol. Its IUPAC name is 6-(2,3-dimethylbutyl)-3,4-dimethyl-4H-oxazine.
Molecular Properties
| Compound Name | 6-(2,3-dimethylbutyl)-3,4-dimethyl-4H-oxazine |
| PubChem CID | 146581273 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | 6-(2,3-dimethylbutyl)-3,4-dimethyl-4H-oxazine |
| SMILES | CC1=NOC(CC(C)C(C)C)=CC1C |
| InChI | InChI=1S/C12H21NO/c1-8(2)9(3)6-12-7-10(4)11(5)13-14-12/h7-10H,6H2,1-5H3 |
| InChIKey | FUQPMVZRVUZLSY-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-(2,3-dimethylbutyl)-3,4-dimethyl-4H-oxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2,3-dimethylbutyl)-3,4-dimethyl-4H-oxazine?
The IUPAC name of 6-(2,3-dimethylbutyl)-3,4-dimethyl-4H-oxazine (CID 146581273) is 6-(2,3-dimethylbutyl)-3,4-dimethyl-4H-oxazine.
What is the SMILES notation for 6-(2,3-dimethylbutyl)-3,4-dimethyl-4H-oxazine?
The canonical SMILES for 6-(2,3-dimethylbutyl)-3,4-dimethyl-4H-oxazine is CC1=NOC(CC(C)C(C)C)=CC1C.
What is the InChIKey of 6-(2,3-dimethylbutyl)-3,4-dimethyl-4H-oxazine?
The InChIKey is FUQPMVZRVUZLSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21NO/c1-8(2)9(3)6-12-7-10(4)11(5)13-14-12/h7-10H,6H2,1-5H3.
What are the key properties of 6-(2,3-dimethylbutyl)-3,4-dimethyl-4H-oxazine?
6-(2,3-dimethylbutyl)-3,4-dimethyl-4H-oxazine has a molecular weight of 195.31 g/mol, XLogP of 3.59, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2,3-dimethylbutyl)-3,4-dimethyl-4H-oxazine is sourced from PubChem (CID 146581273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).