C47H34N4S — CID 146581802
9-[4-[9-(4,6-diphenyl-1,3,5-triazin-2-yl)-5,5-dimethyldibenzothiophen-1-yl]phenyl]carbazole (PubChem CID 146581802) has the molecular formula C47H34N4S and a molecular weight of 686.88 g/mol. Its IUPAC name is 9-[4-[9-(4,6-diphenyl-1,3,5-triazin-2-yl)-5,5-dimethyldibenzothiophen-1-yl]phenyl]carbazole.
| Compound Name | 9-[4-[9-(4,6-diphenyl-1,3,5-triazin-2-yl)-5,5-dimethyldibenzothiophen-1-yl]phenyl]carbazole |
|---|---|
| PubChem CID | 146581802 |
| Molecular Formula | C47H34N4S |
| Molecular Weight | 686.88 g/mol |
| Exact Mass | 686.25 |
| IUPAC Name | 9-[4-[9-(4,6-diphenyl-1,3,5-triazin-2-yl)-5,5-dimethyldibenzothiophen-1-yl]phenyl]carbazole |
| SMILES | CS1(C)c2cccc(-c3ccc(-n4c5ccccc5c5ccccc54)cc3)c2-c2c(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)cccc21 |
| InChI | InChI=1S/C47H34N4S/c1-52(2)41-25-13-21-35(31-27-29-34(30-28-31)51-39-23-11-9-19-36(39)37-20-10-12-24-40(37)51)43(41)44-38(22-14-26-42(44)52)47-49-45(32-15-5-3-6-16-32)48-46(50-47)33-17-7-4-8-18-33/h3-30H,1-2H3 |
| InChIKey | JUDXBFFHGCOWRD-UHFFFAOYSA-N |
| XLogP | 12.10 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.88 |
| LogP ≤ 5 | 12.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |