About CID 146581988
CID 146581988 (PubChem CID 146581988) has the molecular formula C33H49FN4O6
and a molecular weight of 616.78 g/mol.
Molecular Properties
| Compound Name | CID 146581988 |
| PubChem CID | 146581988 |
| Molecular Formula | C33H49FN4O6 |
| Molecular Weight | 616.78 g/mol |
| Exact Mass | 616.36 |
| IUPAC Name | — |
| SMILES | CC(C)(N)CNC(=O)CC1CCC2(CC1)OOC1(O2)C2CC3CC1CC(C(O)NCCCNC(=O)c1ccc(F)cc1)(C3)C2 |
| InChI | InChI=1S/C33H49FN4O6/c1-30(2,35)20-38-27(39)16-21-8-10-32(11-9-21)42-33(44-43-32)24-14-22-15-25(33)19-31(17-22,18-24)29(41)37-13-3-12-36-28(40)23-4-6-26(34)7-5-23/h4-7,21-22,24-25,29,37,41H,3,8-20,35H2,1-2H3,(H,36,40)(H,38,39) |
| InChIKey | AWDRKNGTUWGNSJ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 144.17 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 616.78 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze CID 146581988 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 146581988?
The IUPAC name of CID 146581988 (CID 146581988) is not available.
What is the SMILES notation for CID 146581988?
The canonical SMILES for CID 146581988 is CC(C)(N)CNC(=O)CC1CCC2(CC1)OOC1(O2)C2CC3CC1CC(C(O)NCCCNC(=O)c1ccc(F)cc1)(C3)C2.
What is the InChIKey of CID 146581988?
The InChIKey is AWDRKNGTUWGNSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C33H49FN4O6/c1-30(2,35)20-38-27(39)16-21-8-10-32(11-9-21)42-33(44-43-32)24-14-22-15-25(33)19-31(17-22,18-24)29(41)37-13-3-12-36-28(40)23-4-6-26(34)7-5-23/h4-7,21-22,24-25,29,37,41H,3,8-20,35H2,1-2H3,(H,36,40)(H,38,39).
What are the key properties of CID 146581988?
CID 146581988 has a molecular weight of 616.78 g/mol, XLogP of 3.48, 11 rotatable bonds, 5 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for CID 146581988 is sourced from PubChem (CID 146581988), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).