C53H34N4O — CID 146582036
6-[9-[4-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]fluoren-9-yl]-2-phenyl-1,3-benzoxazole (PubChem CID 146582036) has the molecular formula C53H34N4O and a molecular weight of 742.88 g/mol. Its IUPAC name is 6-[9-[4-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]fluoren-9-yl]-2-phenyl-1,3-benzoxazole.
| Compound Name | 6-[9-[4-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]fluoren-9-yl]-2-phenyl-1,3-benzoxazole |
|---|---|
| PubChem CID | 146582036 |
| Molecular Formula | C53H34N4O |
| Molecular Weight | 742.88 g/mol |
| Exact Mass | 742.27 |
| IUPAC Name | 6-[9-[4-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]fluoren-9-yl]-2-phenyl-1,3-benzoxazole |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3ccc(-c4ccc(C5(c6ccc7nc(-c8ccccc8)oc7c6)c6ccccc6-c6ccccc65)cc4)cc3)n2)cc1 |
| InChI | InChI=1S/C53H34N4O/c1-4-14-37(15-5-1)49-55-50(38-16-6-2-7-17-38)57-51(56-49)39-26-24-35(25-27-39)36-28-30-41(31-29-36)53(45-22-12-10-20-43(45)44-21-11-13-23-46(44)53)42-32-33-47-48(34-42)58-52(54-47)40-18-8-3-9-19-40/h1-34H |
| InChIKey | GYOFXEMTOJRYFE-UHFFFAOYSA-N |
| XLogP | 12.71 |
| TPSA | 64.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.88 |
| LogP ≤ 5 | 12.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |