About CID 146582136
CID 146582136 (PubChem CID 146582136) has the molecular formula C27H39NO4
and a molecular weight of 441.61 g/mol.
Molecular Properties
| Compound Name | CID 146582136 |
| PubChem CID | 146582136 |
| Molecular Formula | C27H39NO4 |
| Molecular Weight | 441.61 g/mol |
| Exact Mass | 441.29 |
| IUPAC Name | — |
| SMILES | CCC1CC2CC(C)CC(C2)[C@@]12OO[C@@]1(CCC[C@@H](c3ccc(CCC(N)=O)cc3)C1)O2 |
| InChI | InChI=1S/C27H39NO4/c1-3-23-15-20-13-18(2)14-24(16-20)27(23)30-26(31-32-27)12-4-5-22(17-26)21-9-6-19(7-10-21)8-11-25(28)29/h6-7,9-10,18,20,22-24H,3-5,8,11-17H2,1-2H3,(H2,28,29)/t18?,20?,22-,23?,24?,26-,27+/m1/s1 |
| InChIKey | YWZPWXIBAZEVFS-WVQSQLHFSA-N |
| XLogP | 5.62 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 441.61 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze CID 146582136 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 146582136?
The IUPAC name of CID 146582136 (CID 146582136) is not available.
What is the SMILES notation for CID 146582136?
The canonical SMILES for CID 146582136 is CCC1CC2CC(C)CC(C2)[C@@]12OO[C@@]1(CCC[C@@H](c3ccc(CCC(N)=O)cc3)C1)O2.
What is the InChIKey of CID 146582136?
The InChIKey is YWZPWXIBAZEVFS-WVQSQLHFSA-N. The full InChI is InChI=1S/C27H39NO4/c1-3-23-15-20-13-18(2)14-24(16-20)27(23)30-26(31-32-27)12-4-5-22(17-26)21-9-6-19(7-10-21)8-11-25(28)29/h6-7,9-10,18,20,22-24H,3-5,8,11-17H2,1-2H3,(H2,28,29)/t18?,20?,22-,23?,24?,26-,27+/m1/s1.
What are the key properties of CID 146582136?
CID 146582136 has a molecular weight of 441.61 g/mol, XLogP of 5.62, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 146582136 is sourced from PubChem (CID 146582136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).