C10H16F3NO — CID 146582433
1-methyl-4-[(E)-4,4,4-trifluorobut-1-enyl]piperidin-4-ol (PubChem CID 146582433) has the molecular formula C10H16F3NO and a molecular weight of 223.24 g/mol. Its IUPAC name is 1-methyl-4-[(E)-4,4,4-trifluorobut-1-enyl]piperidin-4-ol.
| Compound Name | 1-methyl-4-[(E)-4,4,4-trifluorobut-1-enyl]piperidin-4-ol |
|---|---|
| PubChem CID | 146582433 |
| Molecular Formula | C10H16F3NO |
| Molecular Weight | 223.24 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | 1-methyl-4-[(E)-4,4,4-trifluorobut-1-enyl]piperidin-4-ol |
| SMILES | CN1CCC(O)(/C=C/CC(F)(F)F)CC1 |
| InChI | InChI=1S/C10H16F3NO/c1-14-7-5-9(15,6-8-14)3-2-4-10(11,12)13/h2-3,15H,4-8H2,1H3/b3-2+ |
| InChIKey | OXZFBZQGUAQDLZ-NSCUHMNNSA-N |
| XLogP | 1.95 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.24 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|