C10H19F2NO — CID 146582865
3-[4-(2,2-difluorocyclopropyl)butylamino]propan-1-ol (PubChem CID 146582865) has the molecular formula C10H19F2NO and a molecular weight of 207.26 g/mol. Its IUPAC name is 3-[4-(2,2-difluorocyclopropyl)butylamino]propan-1-ol.
| Compound Name | 3-[4-(2,2-difluorocyclopropyl)butylamino]propan-1-ol |
|---|---|
| PubChem CID | 146582865 |
| Molecular Formula | C10H19F2NO |
| Molecular Weight | 207.26 g/mol |
| Exact Mass | 207.14 |
| IUPAC Name | 3-[4-(2,2-difluorocyclopropyl)butylamino]propan-1-ol |
| SMILES | OCCCNCCCCC1CC1(F)F |
| InChI | InChI=1S/C10H19F2NO/c11-10(12)8-9(10)4-1-2-5-13-6-3-7-14/h9,13-14H,1-8H2 |
| InChIKey | NOHIELYFKCIBJJ-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.26 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|