C24H40N2O4 — CID 146582920
(4R)-4-[(3R,5R,7E,8R,9S,10S,12S,13R,14S,17R)-7-hydrazinylidene-3,12-dihydroxy-10,13-dimethyl-1,2,3,4,5,6,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoic acid (PubChem CID 146582920) has the molecular formula C24H40N2O4 and a molecular weight of 420.59 g/mol. Its IUPAC name is (4R)-4-[(3R,5R,7E,8R,9S,10S,12S,13R,14S,17R)-7-hydrazinylidene-3,12-dihydroxy-10,13-dimethyl-1,2,3,4,5,6,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoic acid.
| Compound Name | (4R)-4-[(3R,5R,7E,8R,9S,10S,12S,13R,14S,17R)-7-hydrazinylidene-3,12-dihydroxy-10,13-dimethyl-1,2,3,4,5,6,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoic acid |
|---|---|
| PubChem CID | 146582920 |
| Molecular Formula | C24H40N2O4 |
| Molecular Weight | 420.59 g/mol |
| Exact Mass | 420.30 |
| IUPAC Name | (4R)-4-[(3R,5R,7E,8R,9S,10S,12S,13R,14S,17R)-7-hydrazinylidene-3,12-dihydroxy-10,13-dimethyl-1,2,3,4,5,6,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]pentanoic acid |
| SMILES | C[C@H](CCC(=O)O)[C@H]1CC[C@H]2[C@@H]3/C(=N/N)C[C@@H]4C[C@H](O)CC[C@]4(C)[C@H]3C[C@H](O)[C@]12C |
| InChI | InChI=1S/C24H40N2O4/c1-13(4-7-21(29)30)16-5-6-17-22-18(12-20(28)24(16,17)3)23(2)9-8-15(27)10-14(23)11-19(22)26-25/h13-18,20,22,27-28H,4-12,25H2,1-3H3,(H,29,30)/b26-19+/t13-,14+,15-,16-,17+,18+,20+,22+,23+,24-/m1/s1 |
| InChIKey | KBWNPWZIESQBLT-PZSIBPPDSA-N |
| XLogP | 3.40 |
| TPSA | 116.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.59 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|