C15H23N3 — CID 146583373
1-[(3Z,5Z)-hepta-3,5-dien-3-yl]-N-[(Z)-4-iminopent-2-en-2-yl]azetidin-3-imine (PubChem CID 146583373) has the molecular formula C15H23N3 and a molecular weight of 245.37 g/mol. Its IUPAC name is 1-[(3Z,5Z)-hepta-3,5-dien-3-yl]-N-[(Z)-4-iminopent-2-en-2-yl]azetidin-3-imine.
| Compound Name | 1-[(3Z,5Z)-hepta-3,5-dien-3-yl]-N-[(Z)-4-iminopent-2-en-2-yl]azetidin-3-imine |
|---|---|
| PubChem CID | 146583373 |
| Molecular Formula | C15H23N3 |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.19 |
| IUPAC Name | 1-[(3Z,5Z)-hepta-3,5-dien-3-yl]-N-[(Z)-4-iminopent-2-en-2-yl]azetidin-3-imine |
| SMILES | [H]/N=C(C)/C=C(/C)N=C1CN(/C(=C\C=C/C)CC)C1 |
| InChI | InChI=1S/C15H23N3/c1-5-7-8-15(6-2)18-10-14(11-18)17-13(4)9-12(3)16/h5,7-9,16H,6,10-11H2,1-4H3/b7-5-,13-9-,15-8-,16-12+ |
| InChIKey | OFRVJCMFVIBKKN-NBFZVNCJSA-N |
| XLogP | 3.56 |
| TPSA | 39.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|