About (E)-N,N-diethyl-4-(methoxymethoxy)-3-methylbut-2-en-1-amine
(E)-N,N-diethyl-4-(methoxymethoxy)-3-methylbut-2-en-1-amine (PubChem CID 14658340) has the molecular formula C11H23NO2
and a molecular weight of 201.31 g/mol. Its IUPAC name is (E)-N,N-diethyl-4-(methoxymethoxy)-3-methylbut-2-en-1-amine.
Molecular Properties
| Compound Name | (E)-N,N-diethyl-4-(methoxymethoxy)-3-methylbut-2-en-1-amine |
| PubChem CID | 14658340 |
| Molecular Formula | C11H23NO2 |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.17 |
| IUPAC Name | (E)-N,N-diethyl-4-(methoxymethoxy)-3-methylbut-2-en-1-amine |
| SMILES | CCN(CC)C/C=C(\C)COCOC |
| InChI | InChI=1S/C11H23NO2/c1-5-12(6-2)8-7-11(3)9-14-10-13-4/h7H,5-6,8-10H2,1-4H3/b11-7+ |
| InChIKey | GBJCDXBRVADOIT-YRNVUSSQSA-N |
| XLogP | 1.89 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-N,N-diethyl-4-(methoxymethoxy)-3-methylbut-2-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N,N-diethyl-4-(methoxymethoxy)-3-methylbut-2-en-1-amine?
The IUPAC name of (E)-N,N-diethyl-4-(methoxymethoxy)-3-methylbut-2-en-1-amine (CID 14658340) is (E)-N,N-diethyl-4-(methoxymethoxy)-3-methylbut-2-en-1-amine.
What is the SMILES notation for (E)-N,N-diethyl-4-(methoxymethoxy)-3-methylbut-2-en-1-amine?
The canonical SMILES for (E)-N,N-diethyl-4-(methoxymethoxy)-3-methylbut-2-en-1-amine is CCN(CC)C/C=C(\C)COCOC.
What is the InChIKey of (E)-N,N-diethyl-4-(methoxymethoxy)-3-methylbut-2-en-1-amine?
The InChIKey is GBJCDXBRVADOIT-YRNVUSSQSA-N. The full InChI is InChI=1S/C11H23NO2/c1-5-12(6-2)8-7-11(3)9-14-10-13-4/h7H,5-6,8-10H2,1-4H3/b11-7+.
What are the key properties of (E)-N,N-diethyl-4-(methoxymethoxy)-3-methylbut-2-en-1-amine?
(E)-N,N-diethyl-4-(methoxymethoxy)-3-methylbut-2-en-1-amine has a molecular weight of 201.31 g/mol, XLogP of 1.89, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N,N-diethyl-4-(methoxymethoxy)-3-methylbut-2-en-1-amine is sourced from PubChem (CID 14658340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).