C36H33N5O3 — CID 146583440
(2S)-3-[8-(4,5,6-trimethyl-3-oxopyrazin-2-yl)imidazo[1,2-a]pyridin-5-yl]-2-(tritylamino)propanoic acid (PubChem CID 146583440) has the molecular formula C36H33N5O3 and a molecular weight of 583.69 g/mol. Its IUPAC name is (2S)-3-[8-(4,5,6-trimethyl-3-oxopyrazin-2-yl)imidazo[1,2-a]pyridin-5-yl]-2-(tritylamino)propanoic acid.
| Compound Name | (2S)-3-[8-(4,5,6-trimethyl-3-oxopyrazin-2-yl)imidazo[1,2-a]pyridin-5-yl]-2-(tritylamino)propanoic acid |
|---|---|
| PubChem CID | 146583440 |
| Molecular Formula | C36H33N5O3 |
| Molecular Weight | 583.69 g/mol |
| Exact Mass | 583.26 |
| IUPAC Name | (2S)-3-[8-(4,5,6-trimethyl-3-oxopyrazin-2-yl)imidazo[1,2-a]pyridin-5-yl]-2-(tritylamino)propanoic acid |
| SMILES | Cc1nc(-c2ccc(C[C@H](NC(c3ccccc3)(c3ccccc3)c3ccccc3)C(=O)O)n3ccnc23)c(=O)n(C)c1C |
| InChI | InChI=1S/C36H33N5O3/c1-24-25(2)40(3)34(42)32(38-24)30-20-19-29(41-22-21-37-33(30)41)23-31(35(43)44)39-36(26-13-7-4-8-14-26,27-15-9-5-10-16-27)28-17-11-6-12-18-28/h4-22,31,39H,23H2,1-3H3,(H,43,44)/t31-/m0/s1 |
| InChIKey | YTIRTMWXFYRYSZ-HKBQPEDESA-N |
| XLogP | 5.29 |
| TPSA | 101.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.69 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|