C13H30N4O — CID 146584190
(2,7-dimethyl-1,4,7,10-tetrazacyclotetradec-1-yl)methanol (PubChem CID 146584190) has the molecular formula C13H30N4O and a molecular weight of 258.41 g/mol. Its IUPAC name is (2,7-dimethyl-1,4,7,10-tetrazacyclotetradec-1-yl)methanol.
| Compound Name | (2,7-dimethyl-1,4,7,10-tetrazacyclotetradec-1-yl)methanol |
|---|---|
| PubChem CID | 146584190 |
| Molecular Formula | C13H30N4O |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.24 |
| IUPAC Name | (2,7-dimethyl-1,4,7,10-tetrazacyclotetradec-1-yl)methanol |
| SMILES | CC1CNCCN(C)CCNCCCCN1CO |
| InChI | InChI=1S/C13H30N4O/c1-13-11-15-7-10-16(2)9-6-14-5-3-4-8-17(13)12-18/h13-15,18H,3-12H2,1-2H3 |
| InChIKey | HASUXIZUZVEYJO-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 50.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |