C20H34O4Si — CID 14658468
methyl (2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-methyl-5-phenylmethoxypentanoate (PubChem CID 14658468) has the molecular formula C20H34O4Si and a molecular weight of 366.57 g/mol. Its IUPAC name is methyl (2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-methyl-5-phenylmethoxypentanoate.
| Compound Name | methyl (2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-methyl-5-phenylmethoxypentanoate |
|---|---|
| PubChem CID | 14658468 |
| Molecular Formula | C20H34O4Si |
| Molecular Weight | 366.57 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | methyl (2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2-methyl-5-phenylmethoxypentanoate |
| SMILES | COC(=O)[C@H](C)[C@H](CCOCc1ccccc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H34O4Si/c1-16(19(21)22-5)18(24-25(6,7)20(2,3)4)13-14-23-15-17-11-9-8-10-12-17/h8-12,16,18H,13-15H2,1-7H3/t16-,18+/m1/s1 |
| InChIKey | UCQIASCQVTXJJJ-AEFFLSMTSA-N |
| XLogP | 4.79 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.57 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|