C21H19F2N3O3 — CID 146585221
(8R)-8-tert-butyl-3-fluoro-4-(4-fluorophenyl)-12-oxo-5,6,9-triazatricyclo[7.4.0.02,6]trideca-1(13),2,4,10-tetraene-11-carboxylic acid (PubChem CID 146585221) has the molecular formula C21H19F2N3O3 and a molecular weight of 399.40 g/mol. Its IUPAC name is (8R)-8-tert-butyl-3-fluoro-4-(4-fluorophenyl)-12-oxo-5,6,9-triazatricyclo[7.4.0.02,6]trideca-1(13),2,4,10-tetraene-11-carboxylic acid.
| Compound Name | (8R)-8-tert-butyl-3-fluoro-4-(4-fluorophenyl)-12-oxo-5,6,9-triazatricyclo[7.4.0.02,6]trideca-1(13),2,4,10-tetraene-11-carboxylic acid |
|---|---|
| PubChem CID | 146585221 |
| Molecular Formula | C21H19F2N3O3 |
| Molecular Weight | 399.40 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | (8R)-8-tert-butyl-3-fluoro-4-(4-fluorophenyl)-12-oxo-5,6,9-triazatricyclo[7.4.0.02,6]trideca-1(13),2,4,10-tetraene-11-carboxylic acid |
| SMILES | CC(C)(C)[C@@H]1Cn2nc(-c3ccc(F)cc3)c(F)c2-c2cc(=O)c(C(=O)O)cn21 |
| InChI | InChI=1S/C21H19F2N3O3/c1-21(2,3)16-10-26-19(14-8-15(27)13(20(28)29)9-25(14)16)17(23)18(24-26)11-4-6-12(22)7-5-11/h4-9,16H,10H2,1-3H3,(H,28,29)/t16-/m0/s1 |
| InChIKey | SEVGJHSCVOHQPP-INIZCTEOSA-N |
| XLogP | 3.96 |
| TPSA | 77.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.40 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |