C22H22FN5O2S — CID 146585641
2-(5-fluoro-3-piperidin-4-ylcinnolin-7-yl)-4,6-dimethyl-[1,3]thiazolo[5,4-c]pyridine;formic acid (PubChem CID 146585641) has the molecular formula C22H22FN5O2S and a molecular weight of 439.52 g/mol. Its IUPAC name is 2-(5-fluoro-3-piperidin-4-ylcinnolin-7-yl)-4,6-dimethyl-[1,3]thiazolo[5,4-c]pyridine;formic acid.
| Compound Name | 2-(5-fluoro-3-piperidin-4-ylcinnolin-7-yl)-4,6-dimethyl-[1,3]thiazolo[5,4-c]pyridine;formic acid |
|---|---|
| PubChem CID | 146585641 |
| Molecular Formula | C22H22FN5O2S |
| Molecular Weight | 439.52 g/mol |
| Exact Mass | 439.15 |
| IUPAC Name | 2-(5-fluoro-3-piperidin-4-ylcinnolin-7-yl)-4,6-dimethyl-[1,3]thiazolo[5,4-c]pyridine;formic acid |
| SMILES | Cc1cc2nc(-c3cc(F)c4cc(C5CCNCC5)nnc4c3)sc2c(C)n1.O=CO |
| InChI | InChI=1S/C21H20FN5S.CH2O2/c1-11-7-19-20(12(2)24-11)28-21(25-19)14-8-16(22)15-10-17(26-27-18(15)9-14)13-3-5-23-6-4-13;2-1-3/h7-10,13,23H,3-6H2,1-2H3;1H,(H,2,3) |
| InChIKey | SBNASBVQMKKKQR-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 100.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.52 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|