About [1,3-dihydrotriazolo[4,5-b]pyridin-2-yloxy(dimethylamino)methylidene]-dimethylazanium
[1,3-dihydrotriazolo[4,5-b]pyridin-2-yloxy(dimethylamino)methylidene]-dimethylazanium (PubChem CID 146585736) has the molecular formula C10H17N6O+
and a molecular weight of 237.29 g/mol. Its IUPAC name is [1,3-dihydrotriazolo[4,5-b]pyridin-2-yloxy(dimethylamino)methylidene]-dimethylazanium.
Molecular Properties
| Compound Name | [1,3-dihydrotriazolo[4,5-b]pyridin-2-yloxy(dimethylamino)methylidene]-dimethylazanium |
| PubChem CID | 146585736 |
| Molecular Formula | C10H17N6O+ |
| Molecular Weight | 237.29 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | [1,3-dihydrotriazolo[4,5-b]pyridin-2-yloxy(dimethylamino)methylidene]-dimethylazanium |
| SMILES | CN(C)C(ON1Nc2cccnc2N1)=[N+](C)C |
| InChI | InChI=1S/C10H17N6O/c1-14(2)10(15(3)4)17-16-12-8-6-5-7-11-9(8)13-16/h5-7,12H,1-4H3,(H,11,13)/q+1 |
| InChIKey | SKCXNXKYYMIONV-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 55.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.29 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze [1,3-dihydrotriazolo[4,5-b]pyridin-2-yloxy(dimethylamino)methylidene]-dimethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1,3-dihydrotriazolo[4,5-b]pyridin-2-yloxy(dimethylamino)methylidene]-dimethylazanium?
The IUPAC name of [1,3-dihydrotriazolo[4,5-b]pyridin-2-yloxy(dimethylamino)methylidene]-dimethylazanium (CID 146585736) is [1,3-dihydrotriazolo[4,5-b]pyridin-2-yloxy(dimethylamino)methylidene]-dimethylazanium.
What is the SMILES notation for [1,3-dihydrotriazolo[4,5-b]pyridin-2-yloxy(dimethylamino)methylidene]-dimethylazanium?
The canonical SMILES for [1,3-dihydrotriazolo[4,5-b]pyridin-2-yloxy(dimethylamino)methylidene]-dimethylazanium is CN(C)C(ON1Nc2cccnc2N1)=[N+](C)C.
What is the InChIKey of [1,3-dihydrotriazolo[4,5-b]pyridin-2-yloxy(dimethylamino)methylidene]-dimethylazanium?
The InChIKey is SKCXNXKYYMIONV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N6O/c1-14(2)10(15(3)4)17-16-12-8-6-5-7-11-9(8)13-16/h5-7,12H,1-4H3,(H,11,13)/q+1.
What are the key properties of [1,3-dihydrotriazolo[4,5-b]pyridin-2-yloxy(dimethylamino)methylidene]-dimethylazanium?
[1,3-dihydrotriazolo[4,5-b]pyridin-2-yloxy(dimethylamino)methylidene]-dimethylazanium has a molecular weight of 237.29 g/mol, XLogP of 0.17, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1,3-dihydrotriazolo[4,5-b]pyridin-2-yloxy(dimethylamino)methylidene]-dimethylazanium is sourced from PubChem (CID 146585736), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).