C18H18N8O6S — CID 146585791
[2-[[3-[(1R,7S)-5-methyl-9-oxo-10-prop-2-enoxy-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-7-yl]-5-oxo-1,2,4-oxadiazol-4-yl]methyl]-1,3-thiazol-4-yl]carbamic acid (PubChem CID 146585791) has the molecular formula C18H18N8O6S and a molecular weight of 474.46 g/mol. Its IUPAC name is [2-[[3-[(1R,7S)-5-methyl-9-oxo-10-prop-2-enoxy-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-7-yl]-5-oxo-1,2,4-oxadiazol-4-yl]methyl]-1,3-thiazol-4-yl]carbamic acid.
| Compound Name | [2-[[3-[(1R,7S)-5-methyl-9-oxo-10-prop-2-enoxy-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-7-yl]-5-oxo-1,2,4-oxadiazol-4-yl]methyl]-1,3-thiazol-4-yl]carbamic acid |
|---|---|
| PubChem CID | 146585791 |
| Molecular Formula | C18H18N8O6S |
| Molecular Weight | 474.46 g/mol |
| Exact Mass | 474.11 |
| IUPAC Name | [2-[[3-[(1R,7S)-5-methyl-9-oxo-10-prop-2-enoxy-4,5,8,10-tetrazatricyclo[6.2.1.02,6]undeca-2(6),3-dien-7-yl]-5-oxo-1,2,4-oxadiazol-4-yl]methyl]-1,3-thiazol-4-yl]carbamic acid |
| SMILES | C=CCON1C(=O)N2C[C@H]1c1cnn(C)c1[C@H]2c1noc(=O)n1Cc1nc(NC(=O)O)cs1 |
| InChI | InChI=1S/C18H18N8O6S/c1-3-4-31-26-10-6-24(17(26)29)14(13-9(10)5-19-23(13)2)15-22-32-18(30)25(15)7-12-20-11(8-33-12)21-16(27)28/h3,5,8,10,14,21H,1,4,6-7H2,2H3,(H,27,28)/t10-,14-/m0/s1 |
| InChIKey | CAPZNIHWVNKXSP-HZMBPMFUSA-N |
| XLogP | 1.16 |
| TPSA | 160.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.46 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|