C11H19F2N — CID 146586088
(2E,4Z)-N-butan-2-yl-6,6-difluorohepta-2,4-dien-3-amine (PubChem CID 146586088) has the molecular formula C11H19F2N and a molecular weight of 203.28 g/mol. Its IUPAC name is (2E,4Z)-N-butan-2-yl-6,6-difluorohepta-2,4-dien-3-amine.
| Compound Name | (2E,4Z)-N-butan-2-yl-6,6-difluorohepta-2,4-dien-3-amine |
|---|---|
| PubChem CID | 146586088 |
| Molecular Formula | C11H19F2N |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.15 |
| IUPAC Name | (2E,4Z)-N-butan-2-yl-6,6-difluorohepta-2,4-dien-3-amine |
| SMILES | C/C=C(\C=C/C(C)(F)F)NC(C)CC |
| InChI | InChI=1S/C11H19F2N/c1-5-9(3)14-10(6-2)7-8-11(4,12)13/h6-9,14H,5H2,1-4H3/b8-7-,10-6+ |
| InChIKey | RITMZTYHSDJGLC-SDHBEMGISA-N |
| XLogP | 3.49 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|