C15H26N2 — CID 146587440
2-(4-cyclopentylpiperidin-3-yl)-1,2,3,6-tetrahydropyridine (PubChem CID 146587440) has the molecular formula C15H26N2 and a molecular weight of 234.39 g/mol. Its IUPAC name is 2-(4-cyclopentylpiperidin-3-yl)-1,2,3,6-tetrahydropyridine.
| Compound Name | 2-(4-cyclopentylpiperidin-3-yl)-1,2,3,6-tetrahydropyridine |
|---|---|
| PubChem CID | 146587440 |
| Molecular Formula | C15H26N2 |
| Molecular Weight | 234.39 g/mol |
| Exact Mass | 234.21 |
| IUPAC Name | 2-(4-cyclopentylpiperidin-3-yl)-1,2,3,6-tetrahydropyridine |
| SMILES | C1=CCC(C2CNCCC2C2CCCC2)NC1 |
| InChI | InChI=1S/C15H26N2/c1-2-6-12(5-1)13-8-10-16-11-14(13)15-7-3-4-9-17-15/h3-4,12-17H,1-2,5-11H2 |
| InChIKey | AHCLWJRRXRLQJE-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.39 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|