About 2-[4,6-diethyl-6-(4-ethyl-2-methyloctyl)-3H-1,2-dioxin-3-yl]acetic acid
2-[4,6-diethyl-6-(4-ethyl-2-methyloctyl)-3H-1,2-dioxin-3-yl]acetic acid (PubChem CID 14658761) has the molecular formula C21H38O4
and a molecular weight of 354.53 g/mol. Its IUPAC name is 2-[4,6-diethyl-6-(4-ethyl-2-methyloctyl)-3H-1,2-dioxin-3-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[4,6-diethyl-6-(4-ethyl-2-methyloctyl)-3H-1,2-dioxin-3-yl]acetic acid |
| PubChem CID | 14658761 |
| Molecular Formula | C21H38O4 |
| Molecular Weight | 354.53 g/mol |
| Exact Mass | 354.28 |
| IUPAC Name | 2-[4,6-diethyl-6-(4-ethyl-2-methyloctyl)-3H-1,2-dioxin-3-yl]acetic acid |
| SMILES | CCCCC(CC)CC(C)CC1(CC)C=C(CC)C(CC(=O)O)OO1 |
| InChI | InChI=1S/C21H38O4/c1-6-10-11-17(7-2)12-16(5)14-21(9-4)15-18(8-3)19(24-25-21)13-20(22)23/h15-17,19H,6-14H2,1-5H3,(H,22,23) |
| InChIKey | PGURXSLSPSOJSS-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 354.53 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 2-[4,6-diethyl-6-(4-ethyl-2-methyloctyl)-3H-1,2-dioxin-3-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4,6-diethyl-6-(4-ethyl-2-methyloctyl)-3H-1,2-dioxin-3-yl]acetic acid?
The IUPAC name of 2-[4,6-diethyl-6-(4-ethyl-2-methyloctyl)-3H-1,2-dioxin-3-yl]acetic acid (CID 14658761) is 2-[4,6-diethyl-6-(4-ethyl-2-methyloctyl)-3H-1,2-dioxin-3-yl]acetic acid.
What is the SMILES notation for 2-[4,6-diethyl-6-(4-ethyl-2-methyloctyl)-3H-1,2-dioxin-3-yl]acetic acid?
The canonical SMILES for 2-[4,6-diethyl-6-(4-ethyl-2-methyloctyl)-3H-1,2-dioxin-3-yl]acetic acid is CCCCC(CC)CC(C)CC1(CC)C=C(CC)C(CC(=O)O)OO1.
What is the InChIKey of 2-[4,6-diethyl-6-(4-ethyl-2-methyloctyl)-3H-1,2-dioxin-3-yl]acetic acid?
The InChIKey is PGURXSLSPSOJSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H38O4/c1-6-10-11-17(7-2)12-16(5)14-21(9-4)15-18(8-3)19(24-25-21)13-20(22)23/h15-17,19H,6-14H2,1-5H3,(H,22,23).
What are the key properties of 2-[4,6-diethyl-6-(4-ethyl-2-methyloctyl)-3H-1,2-dioxin-3-yl]acetic acid?
2-[4,6-diethyl-6-(4-ethyl-2-methyloctyl)-3H-1,2-dioxin-3-yl]acetic acid has a molecular weight of 354.53 g/mol, XLogP of 5.91, 12 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4,6-diethyl-6-(4-ethyl-2-methyloctyl)-3H-1,2-dioxin-3-yl]acetic acid is sourced from PubChem (CID 14658761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).