C15H24N2 — CID 146587969
(2E,4Z,7Z)-N-ethenyl-7-ethyl-N-[(Z)-ethylideneamino]nona-2,4,7-trien-3-amine (PubChem CID 146587969) has the molecular formula C15H24N2 and a molecular weight of 232.37 g/mol. Its IUPAC name is (2E,4Z,7Z)-N-ethenyl-7-ethyl-N-[(Z)-ethylideneamino]nona-2,4,7-trien-3-amine.
| Compound Name | (2E,4Z,7Z)-N-ethenyl-7-ethyl-N-[(Z)-ethylideneamino]nona-2,4,7-trien-3-amine |
|---|---|
| PubChem CID | 146587969 |
| Molecular Formula | C15H24N2 |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.19 |
| IUPAC Name | (2E,4Z,7Z)-N-ethenyl-7-ethyl-N-[(Z)-ethylideneamino]nona-2,4,7-trien-3-amine |
| SMILES | C=CN(/N=C\C)C(/C=C\C/C(=C\C)CC)=C/C |
| InChI | InChI=1S/C15H24N2/c1-6-14(7-2)12-11-13-15(8-3)17(10-5)16-9-4/h6,8-11,13H,5,7,12H2,1-4H3/b13-11-,14-6-,15-8+,16-9- |
| InChIKey | RVLIOHNHSQZFPH-DVWIHURESA-N |
| XLogP | 4.64 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|