C26H23N9O — CID 146588163
2-[5-[4-(1H-indazol-5-ylamino)pyrimidin-2-yl]-1,3-dihydroisoindol-2-yl]-3-(pyridazin-4-ylamino)propanal (PubChem CID 146588163) has the molecular formula C26H23N9O and a molecular weight of 477.53 g/mol. Its IUPAC name is 2-[5-[4-(1H-indazol-5-ylamino)pyrimidin-2-yl]-1,3-dihydroisoindol-2-yl]-3-(pyridazin-4-ylamino)propanal.
| Compound Name | 2-[5-[4-(1H-indazol-5-ylamino)pyrimidin-2-yl]-1,3-dihydroisoindol-2-yl]-3-(pyridazin-4-ylamino)propanal |
|---|---|
| PubChem CID | 146588163 |
| Molecular Formula | C26H23N9O |
| Molecular Weight | 477.53 g/mol |
| Exact Mass | 477.20 |
| IUPAC Name | 2-[5-[4-(1H-indazol-5-ylamino)pyrimidin-2-yl]-1,3-dihydroisoindol-2-yl]-3-(pyridazin-4-ylamino)propanal |
| SMILES | O=CC(CNc1ccnnc1)N1Cc2ccc(-c3nccc(Nc4ccc5[nH]ncc5c4)n3)cc2C1 |
| InChI | InChI=1S/C26H23N9O/c36-16-23(13-28-22-5-8-29-30-12-22)35-14-18-2-1-17(9-20(18)15-35)26-27-7-6-25(33-26)32-21-3-4-24-19(10-21)11-31-34-24/h1-12,16,23H,13-15H2,(H,28,29)(H,31,34)(H,27,32,33) |
| InChIKey | ABRJJLPKXAUZSY-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 124.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.53 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|