C20H23N3 — CID 146588289
N'-ethyl-2-(methylideneamino)-N-[4-[(3E)-penta-1,3-dien-3-yl]phenyl]cyclopenta-1,3-diene-1-carboximidamide (PubChem CID 146588289) has the molecular formula C20H23N3 and a molecular weight of 305.43 g/mol. Its IUPAC name is N'-ethyl-2-(methylideneamino)-N-[4-[(3E)-penta-1,3-dien-3-yl]phenyl]cyclopenta-1,3-diene-1-carboximidamide.
| Compound Name | N'-ethyl-2-(methylideneamino)-N-[4-[(3E)-penta-1,3-dien-3-yl]phenyl]cyclopenta-1,3-diene-1-carboximidamide |
|---|---|
| PubChem CID | 146588289 |
| Molecular Formula | C20H23N3 |
| Molecular Weight | 305.43 g/mol |
| Exact Mass | 305.19 |
| IUPAC Name | N'-ethyl-2-(methylideneamino)-N-[4-[(3E)-penta-1,3-dien-3-yl]phenyl]cyclopenta-1,3-diene-1-carboximidamide |
| SMILES | C=C/C(=C\C)c1ccc(N/C(=N/CC)C2=C(N=C)C=CC2)cc1 |
| InChI | InChI=1S/C20H23N3/c1-5-15(6-2)16-11-13-17(14-12-16)23-20(22-7-3)18-9-8-10-19(18)21-4/h5-6,8,10-14H,1,4,7,9H2,2-3H3,(H,22,23)/b15-6+ |
| InChIKey | MOKCRTHMQWXBDV-GIDUJCDVSA-N |
| XLogP | 5.02 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.43 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|