About 4,6-diethyl-2-methyl-4H-1,3-thiazine
4,6-diethyl-2-methyl-4H-1,3-thiazine (PubChem CID 146588431) has the molecular formula C9H15NS
and a molecular weight of 169.29 g/mol. Its IUPAC name is 4,6-diethyl-2-methyl-4H-1,3-thiazine.
Molecular Properties
| Compound Name | 4,6-diethyl-2-methyl-4H-1,3-thiazine |
| PubChem CID | 146588431 |
| Molecular Formula | C9H15NS |
| Molecular Weight | 169.29 g/mol |
| Exact Mass | 169.09 |
| IUPAC Name | 4,6-diethyl-2-methyl-4H-1,3-thiazine |
| SMILES | CCC1=CC(CC)N=C(C)S1 |
| InChI | InChI=1S/C9H15NS/c1-4-8-6-9(5-2)11-7(3)10-8/h6,8H,4-5H2,1-3H3 |
| InChIKey | XOBATBBIGPMVCA-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.29 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4,6-diethyl-2-methyl-4H-1,3-thiazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-diethyl-2-methyl-4H-1,3-thiazine?
The IUPAC name of 4,6-diethyl-2-methyl-4H-1,3-thiazine (CID 146588431) is 4,6-diethyl-2-methyl-4H-1,3-thiazine.
What is the SMILES notation for 4,6-diethyl-2-methyl-4H-1,3-thiazine?
The canonical SMILES for 4,6-diethyl-2-methyl-4H-1,3-thiazine is CCC1=CC(CC)N=C(C)S1.
What is the InChIKey of 4,6-diethyl-2-methyl-4H-1,3-thiazine?
The InChIKey is XOBATBBIGPMVCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NS/c1-4-8-6-9(5-2)11-7(3)10-8/h6,8H,4-5H2,1-3H3.
What are the key properties of 4,6-diethyl-2-methyl-4H-1,3-thiazine?
4,6-diethyl-2-methyl-4H-1,3-thiazine has a molecular weight of 169.29 g/mol, XLogP of 3.22, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-diethyl-2-methyl-4H-1,3-thiazine is sourced from PubChem (CID 146588431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).