C20H26N12OS — CID 146588693
2-N-[[2-[2-[[4-amino-6-[(4-methylfuran-3-yl)methylamino]-1,3,5-triazin-2-yl]-methylamino]ethyl]thiophen-3-yl]methyl]-1,3,5-triazine-2,4,6-triamine (PubChem CID 146588693) has the molecular formula C20H26N12OS and a molecular weight of 482.58 g/mol. Its IUPAC name is 2-N-[[2-[2-[[4-amino-6-[(4-methylfuran-3-yl)methylamino]-1,3,5-triazin-2-yl]-methylamino]ethyl]thiophen-3-yl]methyl]-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N-[[2-[2-[[4-amino-6-[(4-methylfuran-3-yl)methylamino]-1,3,5-triazin-2-yl]-methylamino]ethyl]thiophen-3-yl]methyl]-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 146588693 |
| Molecular Formula | C20H26N12OS |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 482.21 |
| IUPAC Name | 2-N-[[2-[2-[[4-amino-6-[(4-methylfuran-3-yl)methylamino]-1,3,5-triazin-2-yl]-methylamino]ethyl]thiophen-3-yl]methyl]-1,3,5-triazine-2,4,6-triamine |
| SMILES | Cc1cocc1CNc1nc(N)nc(N(C)CCc2sccc2CNc2nc(N)nc(N)n2)n1 |
| InChI | InChI=1S/C20H26N12OS/c1-11-9-33-10-13(11)8-25-19-29-17(23)30-20(31-19)32(2)5-3-14-12(4-6-34-14)7-24-18-27-15(21)26-16(22)28-18/h4,6,9-10H,3,5,7-8H2,1-2H3,(H3,23,25,29,30,31)(H5,21,22,24,26,27,28) |
| InChIKey | ZGTWZZJNYIMGMT-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 195.84 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |