C23H34N10OS — CID 146588700
6-N-[[5-[2-[(4-amino-2-methyl-2,5-dihydro-1H-1,3,5-triazin-6-ylidene)amino]ethyl]thiophen-3-yl]methyl]-2-N-[2-(furan-2-yl)ethyl]-2-N,6-N,4-trimethyl-1,4-dihydro-1,3,5-triazine-2,6-diamine (PubChem CID 146588700) has the molecular formula C23H34N10OS and a molecular weight of 498.66 g/mol. Its IUPAC name is 6-N-[[5-[2-[(4-amino-2-methyl-2,5-dihydro-1H-1,3,5-triazin-6-ylidene)amino]ethyl]thiophen-3-yl]methyl]-2-N-[2-(furan-2-yl)ethyl]-2-N,6-N,4-trimethyl-1,4-dihydro-1,3,5-triazine-2,6-diamine.
| Compound Name | 6-N-[[5-[2-[(4-amino-2-methyl-2,5-dihydro-1H-1,3,5-triazin-6-ylidene)amino]ethyl]thiophen-3-yl]methyl]-2-N-[2-(furan-2-yl)ethyl]-2-N,6-N,4-trimethyl-1,4-dihydro-1,3,5-triazine-2,6-diamine |
|---|---|
| PubChem CID | 146588700 |
| Molecular Formula | C23H34N10OS |
| Molecular Weight | 498.66 g/mol |
| Exact Mass | 498.26 |
| IUPAC Name | 6-N-[[5-[2-[(4-amino-2-methyl-2,5-dihydro-1H-1,3,5-triazin-6-ylidene)amino]ethyl]thiophen-3-yl]methyl]-2-N-[2-(furan-2-yl)ethyl]-2-N,6-N,4-trimethyl-1,4-dihydro-1,3,5-triazine-2,6-diamine |
| SMILES | CC1N=C(N(C)CCc2ccco2)NC(N(C)Cc2csc(CC/N=C3/NC(N)=NC(C)N3)c2)=N1 |
| InChI | InChI=1S/C23H34N10OS/c1-15-26-20(24)30-21(27-15)25-9-7-19-12-17(14-35-19)13-33(4)23-29-16(2)28-22(31-23)32(3)10-8-18-6-5-11-34-18/h5-6,11-12,14-16H,7-10,13H2,1-4H3,(H,28,29,31)(H4,24,25,26,27,30) |
| InChIKey | ZKBNQMIEQQXGDO-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 131.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.66 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|