About 7-chloro-5,6-diethyl-2-[4-(trifluoromethyl)cyclohexyl]pyrazolo[1,5-a]pyrimidine
7-chloro-5,6-diethyl-2-[4-(trifluoromethyl)cyclohexyl]pyrazolo[1,5-a]pyrimidine (PubChem CID 146588722) has the molecular formula C17H21ClF3N3
and a molecular weight of 359.82 g/mol. Its IUPAC name is 7-chloro-5,6-diethyl-2-[4-(trifluoromethyl)cyclohexyl]pyrazolo[1,5-a]pyrimidine.
Molecular Properties
| Compound Name | 7-chloro-5,6-diethyl-2-[4-(trifluoromethyl)cyclohexyl]pyrazolo[1,5-a]pyrimidine |
| PubChem CID | 146588722 |
| Molecular Formula | C17H21ClF3N3 |
| Molecular Weight | 359.82 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | 7-chloro-5,6-diethyl-2-[4-(trifluoromethyl)cyclohexyl]pyrazolo[1,5-a]pyrimidine |
| SMILES | CCc1nc2cc(C3CCC(C(F)(F)F)CC3)nn2c(Cl)c1CC |
| InChI | InChI=1S/C17H21ClF3N3/c1-3-12-13(4-2)22-15-9-14(23-24(15)16(12)18)10-5-7-11(8-6-10)17(19,20)21/h9-11H,3-8H2,1-2H3 |
| InChIKey | XATJGPHSETVTBZ-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 359.82 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-chloro-5,6-diethyl-2-[4-(trifluoromethyl)cyclohexyl]pyrazolo[1,5-a]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-5,6-diethyl-2-[4-(trifluoromethyl)cyclohexyl]pyrazolo[1,5-a]pyrimidine?
The IUPAC name of 7-chloro-5,6-diethyl-2-[4-(trifluoromethyl)cyclohexyl]pyrazolo[1,5-a]pyrimidine (CID 146588722) is 7-chloro-5,6-diethyl-2-[4-(trifluoromethyl)cyclohexyl]pyrazolo[1,5-a]pyrimidine.
What is the SMILES notation for 7-chloro-5,6-diethyl-2-[4-(trifluoromethyl)cyclohexyl]pyrazolo[1,5-a]pyrimidine?
The canonical SMILES for 7-chloro-5,6-diethyl-2-[4-(trifluoromethyl)cyclohexyl]pyrazolo[1,5-a]pyrimidine is CCc1nc2cc(C3CCC(C(F)(F)F)CC3)nn2c(Cl)c1CC.
What is the InChIKey of 7-chloro-5,6-diethyl-2-[4-(trifluoromethyl)cyclohexyl]pyrazolo[1,5-a]pyrimidine?
The InChIKey is XATJGPHSETVTBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21ClF3N3/c1-3-12-13(4-2)22-15-9-14(23-24(15)16(12)18)10-5-7-11(8-6-10)17(19,20)21/h9-11H,3-8H2,1-2H3.
What are the key properties of 7-chloro-5,6-diethyl-2-[4-(trifluoromethyl)cyclohexyl]pyrazolo[1,5-a]pyrimidine?
7-chloro-5,6-diethyl-2-[4-(trifluoromethyl)cyclohexyl]pyrazolo[1,5-a]pyrimidine has a molecular weight of 359.82 g/mol, XLogP of 5.34, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-5,6-diethyl-2-[4-(trifluoromethyl)cyclohexyl]pyrazolo[1,5-a]pyrimidine is sourced from PubChem (CID 146588722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).