C16H17ClF3N3O — CID 146588943
8-chloro-5-[4-(trifluoromethyl)cyclohexyl]-12-oxa-2,6,7-triazatricyclo[7.4.0.03,7]trideca-1,3,5,8-tetraene (PubChem CID 146588943) has the molecular formula C16H17ClF3N3O and a molecular weight of 359.78 g/mol. Its IUPAC name is 8-chloro-5-[4-(trifluoromethyl)cyclohexyl]-12-oxa-2,6,7-triazatricyclo[7.4.0.03,7]trideca-1,3,5,8-tetraene.
| Compound Name | 8-chloro-5-[4-(trifluoromethyl)cyclohexyl]-12-oxa-2,6,7-triazatricyclo[7.4.0.03,7]trideca-1,3,5,8-tetraene |
|---|---|
| PubChem CID | 146588943 |
| Molecular Formula | C16H17ClF3N3O |
| Molecular Weight | 359.78 g/mol |
| Exact Mass | 359.10 |
| IUPAC Name | 8-chloro-5-[4-(trifluoromethyl)cyclohexyl]-12-oxa-2,6,7-triazatricyclo[7.4.0.03,7]trideca-1,3,5,8-tetraene |
| SMILES | FC(F)(F)C1CCC(c2cc3nc4c(c(Cl)n3n2)CCOC4)CC1 |
| InChI | InChI=1S/C16H17ClF3N3O/c17-15-11-5-6-24-8-13(11)21-14-7-12(22-23(14)15)9-1-3-10(4-2-9)16(18,19)20/h7,9-10H,1-6,8H2 |
| InChIKey | UXTHLHXTVFRTPP-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 39.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.78 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |