C18H25N11O — CID 146588978
3-N-[2-[1-[[[5-[2-(furan-3-yl)ethylamino]-1H-1,2,4-triazol-3-yl]-methylamino]methyl]pyrrol-3-yl]ethyl]-1H-1,2,4-triazole-3,5-diamine (PubChem CID 146588978) has the molecular formula C18H25N11O and a molecular weight of 411.47 g/mol. Its IUPAC name is 3-N-[2-[1-[[[5-[2-(furan-3-yl)ethylamino]-1H-1,2,4-triazol-3-yl]-methylamino]methyl]pyrrol-3-yl]ethyl]-1H-1,2,4-triazole-3,5-diamine.
| Compound Name | 3-N-[2-[1-[[[5-[2-(furan-3-yl)ethylamino]-1H-1,2,4-triazol-3-yl]-methylamino]methyl]pyrrol-3-yl]ethyl]-1H-1,2,4-triazole-3,5-diamine |
|---|---|
| PubChem CID | 146588978 |
| Molecular Formula | C18H25N11O |
| Molecular Weight | 411.47 g/mol |
| Exact Mass | 411.22 |
| IUPAC Name | 3-N-[2-[1-[[[5-[2-(furan-3-yl)ethylamino]-1H-1,2,4-triazol-3-yl]-methylamino]methyl]pyrrol-3-yl]ethyl]-1H-1,2,4-triazole-3,5-diamine |
| SMILES | CN(Cn1ccc(CCNc2n[nH]c(N)n2)c1)c1n[nH]c(NCCc2ccoc2)n1 |
| InChI | InChI=1S/C18H25N11O/c1-28(18-23-17(26-27-18)21-7-3-14-5-9-30-11-14)12-29-8-4-13(10-29)2-6-20-16-22-15(19)24-25-16/h4-5,8-11H,2-3,6-7,12H2,1H3,(H2,21,23,26,27)(H4,19,20,22,24,25) |
| InChIKey | XLODDRDCVYZBBL-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 154.53 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.47 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |