C14H18F3NO — CID 146589184
1-methyl-4-[1-(2,4,6-trifluorophenoxy)ethyl]piperidine (PubChem CID 146589184) has the molecular formula C14H18F3NO and a molecular weight of 273.30 g/mol. Its IUPAC name is 1-methyl-4-[1-(2,4,6-trifluorophenoxy)ethyl]piperidine.
| Compound Name | 1-methyl-4-[1-(2,4,6-trifluorophenoxy)ethyl]piperidine |
|---|---|
| PubChem CID | 146589184 |
| Molecular Formula | C14H18F3NO |
| Molecular Weight | 273.30 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | 1-methyl-4-[1-(2,4,6-trifluorophenoxy)ethyl]piperidine |
| SMILES | CC(Oc1c(F)cc(F)cc1F)C1CCN(C)CC1 |
| InChI | InChI=1S/C14H18F3NO/c1-9(10-3-5-18(2)6-4-10)19-14-12(16)7-11(15)8-13(14)17/h7-10H,3-6H2,1-2H3 |
| InChIKey | HIQWBNYKWZMOEY-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.30 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |