About 5-(6-chlorohex-1-ynyl)-2,2-dimethyl-3H-pyridine
5-(6-chlorohex-1-ynyl)-2,2-dimethyl-3H-pyridine (PubChem CID 146589257) has the molecular formula C13H18ClN
and a molecular weight of 223.75 g/mol. Its IUPAC name is 5-(6-chlorohex-1-ynyl)-2,2-dimethyl-3H-pyridine.
Molecular Properties
| Compound Name | 5-(6-chlorohex-1-ynyl)-2,2-dimethyl-3H-pyridine |
| PubChem CID | 146589257 |
| Molecular Formula | C13H18ClN |
| Molecular Weight | 223.75 g/mol |
| Exact Mass | 223.11 |
| IUPAC Name | 5-(6-chlorohex-1-ynyl)-2,2-dimethyl-3H-pyridine |
| SMILES | CC1(C)CC=C(C#CCCCCCl)C=N1 |
| InChI | InChI=1S/C13H18ClN/c1-13(2)9-8-12(11-15-13)7-5-3-4-6-10-14/h8,11H,3-4,6,9-10H2,1-2H3 |
| InChIKey | RHYQDZCJVBIOAW-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.75 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-(6-chlorohex-1-ynyl)-2,2-dimethyl-3H-pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(6-chlorohex-1-ynyl)-2,2-dimethyl-3H-pyridine?
The IUPAC name of 5-(6-chlorohex-1-ynyl)-2,2-dimethyl-3H-pyridine (CID 146589257) is 5-(6-chlorohex-1-ynyl)-2,2-dimethyl-3H-pyridine.
What is the SMILES notation for 5-(6-chlorohex-1-ynyl)-2,2-dimethyl-3H-pyridine?
The canonical SMILES for 5-(6-chlorohex-1-ynyl)-2,2-dimethyl-3H-pyridine is CC1(C)CC=C(C#CCCCCCl)C=N1.
What is the InChIKey of 5-(6-chlorohex-1-ynyl)-2,2-dimethyl-3H-pyridine?
The InChIKey is RHYQDZCJVBIOAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18ClN/c1-13(2)9-8-12(11-15-13)7-5-3-4-6-10-14/h8,11H,3-4,6,9-10H2,1-2H3.
What are the key properties of 5-(6-chlorohex-1-ynyl)-2,2-dimethyl-3H-pyridine?
5-(6-chlorohex-1-ynyl)-2,2-dimethyl-3H-pyridine has a molecular weight of 223.75 g/mol, XLogP of 3.58, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(6-chlorohex-1-ynyl)-2,2-dimethyl-3H-pyridine is sourced from PubChem (CID 146589257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).