C15H25N3 — CID 146589382
5-N-(2,4-dimethylpentyl)-5-N-prop-2-enylpyridine-2,5-diamine (PubChem CID 146589382) has the molecular formula C15H25N3 and a molecular weight of 247.39 g/mol. Its IUPAC name is 5-N-(2,4-dimethylpentyl)-5-N-prop-2-enylpyridine-2,5-diamine.
| Compound Name | 5-N-(2,4-dimethylpentyl)-5-N-prop-2-enylpyridine-2,5-diamine |
|---|---|
| PubChem CID | 146589382 |
| Molecular Formula | C15H25N3 |
| Molecular Weight | 247.39 g/mol |
| Exact Mass | 247.20 |
| IUPAC Name | 5-N-(2,4-dimethylpentyl)-5-N-prop-2-enylpyridine-2,5-diamine |
| SMILES | C=CCN(CC(C)CC(C)C)c1ccc(N)nc1 |
| InChI | InChI=1S/C15H25N3/c1-5-8-18(11-13(4)9-12(2)3)14-6-7-15(16)17-10-14/h5-7,10,12-13H,1,8-9,11H2,2-4H3,(H2,16,17) |
| InChIKey | WJCZZNXYPIGQSS-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.39 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|