C13H25N3 — CID 146589714
1,3,3-trimethyl-5-(N-methyl-C-propan-2-ylcarbonimidoyl)-2,6-dihydropyridin-4-amine (PubChem CID 146589714) has the molecular formula C13H25N3 and a molecular weight of 223.36 g/mol. Its IUPAC name is 1,3,3-trimethyl-5-(N-methyl-C-propan-2-ylcarbonimidoyl)-2,6-dihydropyridin-4-amine.
| Compound Name | 1,3,3-trimethyl-5-(N-methyl-C-propan-2-ylcarbonimidoyl)-2,6-dihydropyridin-4-amine |
|---|---|
| PubChem CID | 146589714 |
| Molecular Formula | C13H25N3 |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.20 |
| IUPAC Name | 1,3,3-trimethyl-5-(N-methyl-C-propan-2-ylcarbonimidoyl)-2,6-dihydropyridin-4-amine |
| SMILES | C/N=C(/C1=C(N)C(C)(C)CN(C)C1)C(C)C |
| InChI | InChI=1S/C13H25N3/c1-9(2)11(15-5)10-7-16(6)8-13(3,4)12(10)14/h9H,7-8,14H2,1-6H3/b15-11+ |
| InChIKey | IAIKXZYSZGQLCH-RVDMUPIBSA-N |
| XLogP | 1.90 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|