C13H15F — CID 146589791
1,5-diethyl-2-ethynyl-6-fluorocyclohepta-1,3,5-triene (PubChem CID 146589791) has the molecular formula C13H15F and a molecular weight of 190.26 g/mol. Its IUPAC name is 1,5-diethyl-2-ethynyl-6-fluorocyclohepta-1,3,5-triene.
| Compound Name | 1,5-diethyl-2-ethynyl-6-fluorocyclohepta-1,3,5-triene |
|---|---|
| PubChem CID | 146589791 |
| Molecular Formula | C13H15F |
| Molecular Weight | 190.26 g/mol |
| Exact Mass | 190.12 |
| IUPAC Name | 1,5-diethyl-2-ethynyl-6-fluorocyclohepta-1,3,5-triene |
| SMILES | C#CC1=C(CC)CC(F)=C(CC)C=C1 |
| InChI | InChI=1S/C13H15F/c1-4-10-7-8-11(5-2)13(14)9-12(10)6-3/h1,7-8H,5-6,9H2,2-3H3 |
| InChIKey | GMUQYAVUNDOKAR-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.26 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|