About hex-5-en-2-yl (2S)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoate
hex-5-en-2-yl (2S)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoate (PubChem CID 146589861) has the molecular formula C19H33NO6
and a molecular weight of 371.47 g/mol. Its IUPAC name is hex-5-en-2-yl (2S)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoate.
Molecular Properties
| Compound Name | hex-5-en-2-yl (2S)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoate |
| PubChem CID | 146589861 |
| Molecular Formula | C19H33NO6 |
| Molecular Weight | 371.47 g/mol |
| Exact Mass | 371.23 |
| IUPAC Name | hex-5-en-2-yl (2S)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoate |
| SMILES | C=CCCC(C)OC(=O)[C@H](C)N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H33NO6/c1-10-11-12-13(2)24-15(21)14(3)20(16(22)25-18(4,5)6)17(23)26-19(7,8)9/h10,13-14H,1,11-12H2,2-9H3/t13?,14-/m0/s1 |
| InChIKey | HLENSXHVQSEHKF-KZUDCZAMSA-N |
| XLogP | 4.45 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.47 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze hex-5-en-2-yl (2S)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hex-5-en-2-yl (2S)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoate?
The IUPAC name of hex-5-en-2-yl (2S)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoate (CID 146589861) is hex-5-en-2-yl (2S)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoate.
What is the SMILES notation for hex-5-en-2-yl (2S)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoate?
The canonical SMILES for hex-5-en-2-yl (2S)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoate is C=CCCC(C)OC(=O)[C@H](C)N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C.
What is the InChIKey of hex-5-en-2-yl (2S)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoate?
The InChIKey is HLENSXHVQSEHKF-KZUDCZAMSA-N. The full InChI is InChI=1S/C19H33NO6/c1-10-11-12-13(2)24-15(21)14(3)20(16(22)25-18(4,5)6)17(23)26-19(7,8)9/h10,13-14H,1,11-12H2,2-9H3/t13?,14-/m0/s1.
What are the key properties of hex-5-en-2-yl (2S)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoate?
hex-5-en-2-yl (2S)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoate has a molecular weight of 371.47 g/mol, XLogP of 4.45, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for hex-5-en-2-yl (2S)-2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoate is sourced from PubChem (CID 146589861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).