C18H15Cl3FNOS2 — CID 146589987
[3-(3-methyl-4,5,6,7-tetrahydro-2-benzothiophen-1-yl)-5-(3,4,5-trichlorophenyl)-4H-1,2-oxazol-5-yl] thiohypofluorite (PubChem CID 146589987) has the molecular formula C18H15Cl3FNOS2 and a molecular weight of 450.82 g/mol. Its IUPAC name is [3-(3-methyl-4,5,6,7-tetrahydro-2-benzothiophen-1-yl)-5-(3,4,5-trichlorophenyl)-4H-1,2-oxazol-5-yl] thiohypofluorite.
| Compound Name | [3-(3-methyl-4,5,6,7-tetrahydro-2-benzothiophen-1-yl)-5-(3,4,5-trichlorophenyl)-4H-1,2-oxazol-5-yl] thiohypofluorite |
|---|---|
| PubChem CID | 146589987 |
| Molecular Formula | C18H15Cl3FNOS2 |
| Molecular Weight | 450.82 g/mol |
| Exact Mass | 448.96 |
| IUPAC Name | [3-(3-methyl-4,5,6,7-tetrahydro-2-benzothiophen-1-yl)-5-(3,4,5-trichlorophenyl)-4H-1,2-oxazol-5-yl] thiohypofluorite |
| SMILES | Cc1sc(C2=NOC(SF)(c3cc(Cl)c(Cl)c(Cl)c3)C2)c2c1CCCC2 |
| InChI | InChI=1S/C18H15Cl3FNOS2/c1-9-11-4-2-3-5-12(11)17(25-9)15-8-18(26-22,24-23-15)10-6-13(19)16(21)14(20)7-10/h6-7H,2-5,8H2,1H3 |
| InChIKey | OETBOKWXCBJWDK-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.82 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|