C11H19N5 — CID 146590018
1-[(3E,5E)-6-(1-aminoethenylamino)hexa-1,3,5-trien-3-yl]-2-ethylguanidine (PubChem CID 146590018) has the molecular formula C11H19N5 and a molecular weight of 221.31 g/mol. Its IUPAC name is 1-[(3E,5E)-6-(1-aminoethenylamino)hexa-1,3,5-trien-3-yl]-2-ethylguanidine.
| Compound Name | 1-[(3E,5E)-6-(1-aminoethenylamino)hexa-1,3,5-trien-3-yl]-2-ethylguanidine |
|---|---|
| PubChem CID | 146590018 |
| Molecular Formula | C11H19N5 |
| Molecular Weight | 221.31 g/mol |
| Exact Mass | 221.16 |
| IUPAC Name | 1-[(3E,5E)-6-(1-aminoethenylamino)hexa-1,3,5-trien-3-yl]-2-ethylguanidine |
| SMILES | C=C/C(=C\C=C\NC(=C)N)N/C(N)=N/CC |
| InChI | InChI=1S/C11H19N5/c1-4-10(16-11(13)14-5-2)7-6-8-15-9(3)12/h4,6-8,15H,1,3,5,12H2,2H3,(H3,13,14,16)/b8-6+,10-7+ |
| InChIKey | FKOYXISJPUAJKO-NBANWCDVSA-N |
| XLogP | 0.51 |
| TPSA | 88.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.31 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|