C16H25NS — CID 146590425
(3E,6Z,8E)-N,4-dimethyl-10-methylsulfanyl-6-[(Z)-prop-1-enyl]deca-3,6,8-trien-2-imine (PubChem CID 146590425) has the molecular formula C16H25NS and a molecular weight of 263.45 g/mol. Its IUPAC name is (3E,6Z,8E)-N,4-dimethyl-10-methylsulfanyl-6-[(Z)-prop-1-enyl]deca-3,6,8-trien-2-imine.
| Compound Name | (3E,6Z,8E)-N,4-dimethyl-10-methylsulfanyl-6-[(Z)-prop-1-enyl]deca-3,6,8-trien-2-imine |
|---|---|
| PubChem CID | 146590425 |
| Molecular Formula | C16H25NS |
| Molecular Weight | 263.45 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | (3E,6Z,8E)-N,4-dimethyl-10-methylsulfanyl-6-[(Z)-prop-1-enyl]deca-3,6,8-trien-2-imine |
| SMILES | C/C=C\C(=C/C=C/CSC)C/C(C)=C/C(C)=N/C |
| InChI | InChI=1S/C16H25NS/c1-6-9-16(10-7-8-11-18-5)13-14(2)12-15(3)17-4/h6-10,12H,11,13H2,1-5H3/b8-7+,9-6-,14-12+,16-10+,17-15+ |
| InChIKey | ZHZHYNMWSHTAMA-DZCLJTJBSA-N |
| XLogP | 4.84 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.45 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|