About 2-trityl-6,7-dihydro-5H-pyrazolo[4,3-c]pyridin-4-one
2-trityl-6,7-dihydro-5H-pyrazolo[4,3-c]pyridin-4-one (PubChem CID 146591462) has the molecular formula C25H21N3O
and a molecular weight of 379.46 g/mol. Its IUPAC name is 2-trityl-6,7-dihydro-5H-pyrazolo[4,3-c]pyridin-4-one.
Molecular Properties
| Compound Name | 2-trityl-6,7-dihydro-5H-pyrazolo[4,3-c]pyridin-4-one |
| PubChem CID | 146591462 |
| Molecular Formula | C25H21N3O |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.17 |
| IUPAC Name | 2-trityl-6,7-dihydro-5H-pyrazolo[4,3-c]pyridin-4-one |
| SMILES | O=C1NCCc2nn(C(c3ccccc3)(c3ccccc3)c3ccccc3)cc21 |
| InChI | InChI=1S/C25H21N3O/c29-24-22-18-28(27-23(22)16-17-26-24)25(19-10-4-1-5-11-19,20-12-6-2-7-13-20)21-14-8-3-9-15-21/h1-15,18H,16-17H2,(H,26,29) |
| InChIKey | UPQFBAWTCRNXCH-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze 2-trityl-6,7-dihydro-5H-pyrazolo[4,3-c]pyridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-trityl-6,7-dihydro-5H-pyrazolo[4,3-c]pyridin-4-one?
The IUPAC name of 2-trityl-6,7-dihydro-5H-pyrazolo[4,3-c]pyridin-4-one (CID 146591462) is 2-trityl-6,7-dihydro-5H-pyrazolo[4,3-c]pyridin-4-one.
What is the SMILES notation for 2-trityl-6,7-dihydro-5H-pyrazolo[4,3-c]pyridin-4-one?
The canonical SMILES for 2-trityl-6,7-dihydro-5H-pyrazolo[4,3-c]pyridin-4-one is O=C1NCCc2nn(C(c3ccccc3)(c3ccccc3)c3ccccc3)cc21.
What is the InChIKey of 2-trityl-6,7-dihydro-5H-pyrazolo[4,3-c]pyridin-4-one?
The InChIKey is UPQFBAWTCRNXCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H21N3O/c29-24-22-18-28(27-23(22)16-17-26-24)25(19-10-4-1-5-11-19,20-12-6-2-7-13-20)21-14-8-3-9-15-21/h1-15,18H,16-17H2,(H,26,29).
What are the key properties of 2-trityl-6,7-dihydro-5H-pyrazolo[4,3-c]pyridin-4-one?
2-trityl-6,7-dihydro-5H-pyrazolo[4,3-c]pyridin-4-one has a molecular weight of 379.46 g/mol, XLogP of 4.01, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-trityl-6,7-dihydro-5H-pyrazolo[4,3-c]pyridin-4-one is sourced from PubChem (CID 146591462), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).