About 3-(4-bromo-3-fluorophenyl)-4-[(4-methylpiperidin-1-yl)methyl]-2-oxido-1,2,5-oxadiazol-2-ium
3-(4-bromo-3-fluorophenyl)-4-[(4-methylpiperidin-1-yl)methyl]-2-oxido-1,2,5-oxadiazol-2-ium (PubChem CID 146591524) has the molecular formula C15H17BrFN3O2
and a molecular weight of 370.22 g/mol. Its IUPAC name is 3-(4-bromo-3-fluorophenyl)-4-[(4-methylpiperidin-1-yl)methyl]-2-oxido-1,2,5-oxadiazol-2-ium.
Molecular Properties
| Compound Name | 3-(4-bromo-3-fluorophenyl)-4-[(4-methylpiperidin-1-yl)methyl]-2-oxido-1,2,5-oxadiazol-2-ium |
| PubChem CID | 146591524 |
| Molecular Formula | C15H17BrFN3O2 |
| Molecular Weight | 370.22 g/mol |
| Exact Mass | 369.05 |
| IUPAC Name | 3-(4-bromo-3-fluorophenyl)-4-[(4-methylpiperidin-1-yl)methyl]-2-oxido-1,2,5-oxadiazol-2-ium |
| SMILES | CC1CCN(Cc2no[n+]([O-])c2-c2ccc(Br)c(F)c2)CC1 |
| InChI | InChI=1S/C15H17BrFN3O2/c1-10-4-6-19(7-5-10)9-14-15(20(21)22-18-14)11-2-3-12(16)13(17)8-11/h2-3,8,10H,4-7,9H2,1H3 |
| InChIKey | KLZNACYOKPXTFW-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 56.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.22 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-bromo-3-fluorophenyl)-4-[(4-methylpiperidin-1-yl)methyl]-2-oxido-1,2,5-oxadiazol-2-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-bromo-3-fluorophenyl)-4-[(4-methylpiperidin-1-yl)methyl]-2-oxido-1,2,5-oxadiazol-2-ium?
The IUPAC name of 3-(4-bromo-3-fluorophenyl)-4-[(4-methylpiperidin-1-yl)methyl]-2-oxido-1,2,5-oxadiazol-2-ium (CID 146591524) is 3-(4-bromo-3-fluorophenyl)-4-[(4-methylpiperidin-1-yl)methyl]-2-oxido-1,2,5-oxadiazol-2-ium.
What is the SMILES notation for 3-(4-bromo-3-fluorophenyl)-4-[(4-methylpiperidin-1-yl)methyl]-2-oxido-1,2,5-oxadiazol-2-ium?
The canonical SMILES for 3-(4-bromo-3-fluorophenyl)-4-[(4-methylpiperidin-1-yl)methyl]-2-oxido-1,2,5-oxadiazol-2-ium is CC1CCN(Cc2no[n+]([O-])c2-c2ccc(Br)c(F)c2)CC1.
What is the InChIKey of 3-(4-bromo-3-fluorophenyl)-4-[(4-methylpiperidin-1-yl)methyl]-2-oxido-1,2,5-oxadiazol-2-ium?
The InChIKey is KLZNACYOKPXTFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17BrFN3O2/c1-10-4-6-19(7-5-10)9-14-15(20(21)22-18-14)11-2-3-12(16)13(17)8-11/h2-3,8,10H,4-7,9H2,1H3.
What are the key properties of 3-(4-bromo-3-fluorophenyl)-4-[(4-methylpiperidin-1-yl)methyl]-2-oxido-1,2,5-oxadiazol-2-ium?
3-(4-bromo-3-fluorophenyl)-4-[(4-methylpiperidin-1-yl)methyl]-2-oxido-1,2,5-oxadiazol-2-ium has a molecular weight of 370.22 g/mol, XLogP of 3.11, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-bromo-3-fluorophenyl)-4-[(4-methylpiperidin-1-yl)methyl]-2-oxido-1,2,5-oxadiazol-2-ium is sourced from PubChem (CID 146591524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).