C16H16F3N3O5 — CID 146591549
(4aR,7aR)-6-[[5-oxido-4-[3-(trifluoromethoxy)phenyl]-1,2,5-oxadiazol-5-ium-3-yl]methyl]-2,3,4a,5,7,7a-hexahydro-[1,4]dioxino[2,3-c]pyrrole (PubChem CID 146591549) has the molecular formula C16H16F3N3O5 and a molecular weight of 387.31 g/mol. Its IUPAC name is (4aR,7aR)-6-[[5-oxido-4-[3-(trifluoromethoxy)phenyl]-1,2,5-oxadiazol-5-ium-3-yl]methyl]-2,3,4a,5,7,7a-hexahydro-[1,4]dioxino[2,3-c]pyrrole.
| Compound Name | (4aR,7aR)-6-[[5-oxido-4-[3-(trifluoromethoxy)phenyl]-1,2,5-oxadiazol-5-ium-3-yl]methyl]-2,3,4a,5,7,7a-hexahydro-[1,4]dioxino[2,3-c]pyrrole |
|---|---|
| PubChem CID | 146591549 |
| Molecular Formula | C16H16F3N3O5 |
| Molecular Weight | 387.31 g/mol |
| Exact Mass | 387.10 |
| IUPAC Name | (4aR,7aR)-6-[[5-oxido-4-[3-(trifluoromethoxy)phenyl]-1,2,5-oxadiazol-5-ium-3-yl]methyl]-2,3,4a,5,7,7a-hexahydro-[1,4]dioxino[2,3-c]pyrrole |
| SMILES | [O-][n+]1onc(CN2C[C@H]3OCCO[C@@H]3C2)c1-c1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C16H16F3N3O5/c17-16(18,19)26-11-3-1-2-10(6-11)15-12(20-27-22(15)23)7-21-8-13-14(9-21)25-5-4-24-13/h1-3,6,13-14H,4-5,7-9H2/t13-,14-/m1/s1 |
| InChIKey | YJOUYVWEEQHBPG-ZIAGYGMSSA-N |
| XLogP | 1.47 |
| TPSA | 83.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.31 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'} |
|---|