C30H17F5N2O — CID 146591716
2-[7-(2,3,4,5,6-pentafluorophenyl)-9-pyridin-2-yl-5,6-dihydrobenzo[h]quinolin-2-yl]phenol (PubChem CID 146591716) has the molecular formula C30H17F5N2O and a molecular weight of 516.47 g/mol. Its IUPAC name is 2-[7-(2,3,4,5,6-pentafluorophenyl)-9-pyridin-2-yl-5,6-dihydrobenzo[h]quinolin-2-yl]phenol.
| Compound Name | 2-[7-(2,3,4,5,6-pentafluorophenyl)-9-pyridin-2-yl-5,6-dihydrobenzo[h]quinolin-2-yl]phenol |
|---|---|
| PubChem CID | 146591716 |
| Molecular Formula | C30H17F5N2O |
| Molecular Weight | 516.47 g/mol |
| Exact Mass | 516.13 |
| IUPAC Name | 2-[7-(2,3,4,5,6-pentafluorophenyl)-9-pyridin-2-yl-5,6-dihydrobenzo[h]quinolin-2-yl]phenol |
| SMILES | Oc1ccccc1-c1ccc2c(n1)-c1cc(-c3ccccn3)cc(-c3c(F)c(F)c(F)c(F)c3F)c1CC2 |
| InChI | InChI=1S/C30H17F5N2O/c31-25-24(26(32)28(34)29(35)27(25)33)19-13-16(21-6-3-4-12-36-21)14-20-17(19)10-8-15-9-11-22(37-30(15)20)18-5-1-2-7-23(18)38/h1-7,9,11-14,38H,8,10H2 |
| InChIKey | MWRIIICMRDQOKQ-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.47 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|