About methyl 3-[(1S)-1-(6,8-difluoro-1-oxidoquinolin-1-ium-3-yl)oxyethyl]-4-pyrazol-1-ylbenzoate
methyl 3-[(1S)-1-(6,8-difluoro-1-oxidoquinolin-1-ium-3-yl)oxyethyl]-4-pyrazol-1-ylbenzoate (PubChem CID 146591793) has the molecular formula C22H17F2N3O4
and a molecular weight of 425.39 g/mol. Its IUPAC name is methyl 3-[(1S)-1-(6,8-difluoro-1-oxidoquinolin-1-ium-3-yl)oxyethyl]-4-pyrazol-1-ylbenzoate.
Molecular Properties
| Compound Name | methyl 3-[(1S)-1-(6,8-difluoro-1-oxidoquinolin-1-ium-3-yl)oxyethyl]-4-pyrazol-1-ylbenzoate |
| PubChem CID | 146591793 |
| Molecular Formula | C22H17F2N3O4 |
| Molecular Weight | 425.39 g/mol |
| Exact Mass | 425.12 |
| IUPAC Name | methyl 3-[(1S)-1-(6,8-difluoro-1-oxidoquinolin-1-ium-3-yl)oxyethyl]-4-pyrazol-1-ylbenzoate |
| SMILES | COC(=O)c1ccc(-n2cccn2)c([C@H](C)Oc2cc3cc(F)cc(F)c3[n+]([O-])c2)c1 |
| InChI | InChI=1S/C22H17F2N3O4/c1-13(31-17-9-15-8-16(23)11-19(24)21(15)27(29)12-17)18-10-14(22(28)30-2)4-5-20(18)26-7-3-6-25-26/h3-13H,1-2H3/t13-/m0/s1 |
| InChIKey | NOTFVCBDMASRQR-ZDUSSCGKSA-N |
| XLogP | 3.86 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 425.39 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-[(1S)-1-(6,8-difluoro-1-oxidoquinolin-1-ium-3-yl)oxyethyl]-4-pyrazol-1-ylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[(1S)-1-(6,8-difluoro-1-oxidoquinolin-1-ium-3-yl)oxyethyl]-4-pyrazol-1-ylbenzoate?
The IUPAC name of methyl 3-[(1S)-1-(6,8-difluoro-1-oxidoquinolin-1-ium-3-yl)oxyethyl]-4-pyrazol-1-ylbenzoate (CID 146591793) is methyl 3-[(1S)-1-(6,8-difluoro-1-oxidoquinolin-1-ium-3-yl)oxyethyl]-4-pyrazol-1-ylbenzoate.
What is the SMILES notation for methyl 3-[(1S)-1-(6,8-difluoro-1-oxidoquinolin-1-ium-3-yl)oxyethyl]-4-pyrazol-1-ylbenzoate?
The canonical SMILES for methyl 3-[(1S)-1-(6,8-difluoro-1-oxidoquinolin-1-ium-3-yl)oxyethyl]-4-pyrazol-1-ylbenzoate is COC(=O)c1ccc(-n2cccn2)c([C@H](C)Oc2cc3cc(F)cc(F)c3[n+]([O-])c2)c1.
What is the InChIKey of methyl 3-[(1S)-1-(6,8-difluoro-1-oxidoquinolin-1-ium-3-yl)oxyethyl]-4-pyrazol-1-ylbenzoate?
The InChIKey is NOTFVCBDMASRQR-ZDUSSCGKSA-N. The full InChI is InChI=1S/C22H17F2N3O4/c1-13(31-17-9-15-8-16(23)11-19(24)21(15)27(29)12-17)18-10-14(22(28)30-2)4-5-20(18)26-7-3-6-25-26/h3-13H,1-2H3/t13-/m0/s1.
What are the key properties of methyl 3-[(1S)-1-(6,8-difluoro-1-oxidoquinolin-1-ium-3-yl)oxyethyl]-4-pyrazol-1-ylbenzoate?
methyl 3-[(1S)-1-(6,8-difluoro-1-oxidoquinolin-1-ium-3-yl)oxyethyl]-4-pyrazol-1-ylbenzoate has a molecular weight of 425.39 g/mol, XLogP of 3.86, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[(1S)-1-(6,8-difluoro-1-oxidoquinolin-1-ium-3-yl)oxyethyl]-4-pyrazol-1-ylbenzoate is sourced from PubChem (CID 146591793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).