About 4-bromo-2,3-difluoropyridine;5-bromo-4-fluoro-2-methoxypyridine
4-bromo-2,3-difluoropyridine;5-bromo-4-fluoro-2-methoxypyridine (PubChem CID 146592444) has the molecular formula C11H7Br2F3N2O
and a molecular weight of 399.99 g/mol. Its IUPAC name is 4-bromo-2,3-difluoropyridine;5-bromo-4-fluoro-2-methoxypyridine.
Molecular Properties
| Compound Name | 4-bromo-2,3-difluoropyridine;5-bromo-4-fluoro-2-methoxypyridine |
| PubChem CID | 146592444 |
| Molecular Formula | C11H7Br2F3N2O |
| Molecular Weight | 399.99 g/mol |
| Exact Mass | 397.89 |
| IUPAC Name | 4-bromo-2,3-difluoropyridine;5-bromo-4-fluoro-2-methoxypyridine |
| SMILES | COc1cc(F)c(Br)cn1.Fc1nccc(Br)c1F |
| InChI | InChI=1S/C6H5BrFNO.C5H2BrF2N/c1-10-6-2-5(8)4(7)3-9-6;6-3-1-2-9-5(8)4(3)7/h2-3H,1H3;1-2H |
| InChIKey | YTBDDZKABFOQJF-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.99 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-2,3-difluoropyridine;5-bromo-4-fluoro-2-methoxypyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-2,3-difluoropyridine;5-bromo-4-fluoro-2-methoxypyridine?
The IUPAC name of 4-bromo-2,3-difluoropyridine;5-bromo-4-fluoro-2-methoxypyridine (CID 146592444) is 4-bromo-2,3-difluoropyridine;5-bromo-4-fluoro-2-methoxypyridine.
What is the SMILES notation for 4-bromo-2,3-difluoropyridine;5-bromo-4-fluoro-2-methoxypyridine?
The canonical SMILES for 4-bromo-2,3-difluoropyridine;5-bromo-4-fluoro-2-methoxypyridine is COc1cc(F)c(Br)cn1.Fc1nccc(Br)c1F.
What is the InChIKey of 4-bromo-2,3-difluoropyridine;5-bromo-4-fluoro-2-methoxypyridine?
The InChIKey is YTBDDZKABFOQJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5BrFNO.C5H2BrF2N/c1-10-6-2-5(8)4(7)3-9-6;6-3-1-2-9-5(8)4(3)7/h2-3H,1H3;1-2H.
What are the key properties of 4-bromo-2,3-difluoropyridine;5-bromo-4-fluoro-2-methoxypyridine?
4-bromo-2,3-difluoropyridine;5-bromo-4-fluoro-2-methoxypyridine has a molecular weight of 399.99 g/mol, XLogP of 4.11, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-2,3-difluoropyridine;5-bromo-4-fluoro-2-methoxypyridine is sourced from PubChem (CID 146592444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).