C33H43F5N4O6S — CID 146592531
(2,3,4,5,6-pentafluorophenyl) 2-[1-acetyloxy-4-methyl-3-[methyl-[3-methyl-2-[(2-methyl-2-pyrrolidin-1-ylpropanoyl)amino]pentanoyl]amino]pentyl]-1,3-thiazole-4-carboxylate (PubChem CID 146592531) has the molecular formula C33H43F5N4O6S and a molecular weight of 718.79 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) 2-[1-acetyloxy-4-methyl-3-[methyl-[3-methyl-2-[(2-methyl-2-pyrrolidin-1-ylpropanoyl)amino]pentanoyl]amino]pentyl]-1,3-thiazole-4-carboxylate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) 2-[1-acetyloxy-4-methyl-3-[methyl-[3-methyl-2-[(2-methyl-2-pyrrolidin-1-ylpropanoyl)amino]pentanoyl]amino]pentyl]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 146592531 |
| Molecular Formula | C33H43F5N4O6S |
| Molecular Weight | 718.79 g/mol |
| Exact Mass | 718.28 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) 2-[1-acetyloxy-4-methyl-3-[methyl-[3-methyl-2-[(2-methyl-2-pyrrolidin-1-ylpropanoyl)amino]pentanoyl]amino]pentyl]-1,3-thiazole-4-carboxylate |
| SMILES | CCC(C)C(NC(=O)C(C)(C)N1CCCC1)C(=O)N(C)C(CC(OC(C)=O)c1nc(C(=O)Oc2c(F)c(F)c(F)c(F)c2F)cs1)C(C)C |
| InChI | InChI=1S/C33H43F5N4O6S/c1-9-17(4)27(40-32(46)33(6,7)42-12-10-11-13-42)30(44)41(8)20(16(2)3)14-21(47-18(5)43)29-39-19(15-49-29)31(45)48-28-25(37)23(35)22(34)24(36)26(28)38/h15-17,20-21,27H,9-14H2,1-8H3,(H,40,46) |
| InChIKey | BDVJZLNSPMOBQF-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 118.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.79 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|