About 5-ethenyl-4-hepta-2,3-dien-4-yl-N-hept-1-en-2-yl-8-methyl-N-propylnonan-1-amine
5-ethenyl-4-hepta-2,3-dien-4-yl-N-hept-1-en-2-yl-8-methyl-N-propylnonan-1-amine (PubChem CID 146593464) has the molecular formula C29H53N
and a molecular weight of 415.75 g/mol. Its IUPAC name is 5-ethenyl-4-hepta-2,3-dien-4-yl-N-hept-1-en-2-yl-8-methyl-N-propylnonan-1-amine.
Molecular Properties
| Compound Name | 5-ethenyl-4-hepta-2,3-dien-4-yl-N-hept-1-en-2-yl-8-methyl-N-propylnonan-1-amine |
| PubChem CID | 146593464 |
| Molecular Formula | C29H53N |
| Molecular Weight | 415.75 g/mol |
| Exact Mass | 415.42 |
| IUPAC Name | 5-ethenyl-4-hepta-2,3-dien-4-yl-N-hept-1-en-2-yl-8-methyl-N-propylnonan-1-amine |
| SMILES | C=CC(CCC(C)C)C(CCCN(CCC)C(=C)CCCCC)C(=C=CC)CCC |
| InChI | InChI=1S/C29H53N/c1-9-14-15-19-26(8)30(23-12-4)24-16-20-29(28(17-10-2)18-11-3)27(13-5)22-21-25(6)7/h10,13,25,27,29H,5,8-9,11-12,14-16,18-24H2,1-4,6-7H3 |
| InChIKey | PJYORTXYVLFEOG-UHFFFAOYSA-N |
| XLogP | 9.33 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 415.75 |
| LogP ≤ 5 | 9.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-ethenyl-4-hepta-2,3-dien-4-yl-N-hept-1-en-2-yl-8-methyl-N-propylnonan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethenyl-4-hepta-2,3-dien-4-yl-N-hept-1-en-2-yl-8-methyl-N-propylnonan-1-amine?
The IUPAC name of 5-ethenyl-4-hepta-2,3-dien-4-yl-N-hept-1-en-2-yl-8-methyl-N-propylnonan-1-amine (CID 146593464) is 5-ethenyl-4-hepta-2,3-dien-4-yl-N-hept-1-en-2-yl-8-methyl-N-propylnonan-1-amine.
What is the SMILES notation for 5-ethenyl-4-hepta-2,3-dien-4-yl-N-hept-1-en-2-yl-8-methyl-N-propylnonan-1-amine?
The canonical SMILES for 5-ethenyl-4-hepta-2,3-dien-4-yl-N-hept-1-en-2-yl-8-methyl-N-propylnonan-1-amine is C=CC(CCC(C)C)C(CCCN(CCC)C(=C)CCCCC)C(=C=CC)CCC.
What is the InChIKey of 5-ethenyl-4-hepta-2,3-dien-4-yl-N-hept-1-en-2-yl-8-methyl-N-propylnonan-1-amine?
The InChIKey is PJYORTXYVLFEOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H53N/c1-9-14-15-19-26(8)30(23-12-4)24-16-20-29(28(17-10-2)18-11-3)27(13-5)22-21-25(6)7/h10,13,25,27,29H,5,8-9,11-12,14-16,18-24H2,1-4,6-7H3.
What are the key properties of 5-ethenyl-4-hepta-2,3-dien-4-yl-N-hept-1-en-2-yl-8-methyl-N-propylnonan-1-amine?
5-ethenyl-4-hepta-2,3-dien-4-yl-N-hept-1-en-2-yl-8-methyl-N-propylnonan-1-amine has a molecular weight of 415.75 g/mol, XLogP of 9.33, 19 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethenyl-4-hepta-2,3-dien-4-yl-N-hept-1-en-2-yl-8-methyl-N-propylnonan-1-amine is sourced from PubChem (CID 146593464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).