About 6-methyl-1-prop-2-enyl-3a,4-dihydrobenzimidazole
6-methyl-1-prop-2-enyl-3a,4-dihydrobenzimidazole (PubChem CID 146593647) has the molecular formula C11H14N2
and a molecular weight of 174.25 g/mol. Its IUPAC name is 6-methyl-1-prop-2-enyl-3a,4-dihydrobenzimidazole.
Molecular Properties
| Compound Name | 6-methyl-1-prop-2-enyl-3a,4-dihydrobenzimidazole |
| PubChem CID | 146593647 |
| Molecular Formula | C11H14N2 |
| Molecular Weight | 174.25 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | 6-methyl-1-prop-2-enyl-3a,4-dihydrobenzimidazole |
| SMILES | C=CCN1C=NC2CC=C(C)C=C21 |
| InChI | InChI=1S/C11H14N2/c1-3-6-13-8-12-10-5-4-9(2)7-11(10)13/h3-4,7-8,10H,1,5-6H2,2H3 |
| InChIKey | HEIPXTBPRTZPFT-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.25 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-methyl-1-prop-2-enyl-3a,4-dihydrobenzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-1-prop-2-enyl-3a,4-dihydrobenzimidazole?
The IUPAC name of 6-methyl-1-prop-2-enyl-3a,4-dihydrobenzimidazole (CID 146593647) is 6-methyl-1-prop-2-enyl-3a,4-dihydrobenzimidazole.
What is the SMILES notation for 6-methyl-1-prop-2-enyl-3a,4-dihydrobenzimidazole?
The canonical SMILES for 6-methyl-1-prop-2-enyl-3a,4-dihydrobenzimidazole is C=CCN1C=NC2CC=C(C)C=C21.
What is the InChIKey of 6-methyl-1-prop-2-enyl-3a,4-dihydrobenzimidazole?
The InChIKey is HEIPXTBPRTZPFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2/c1-3-6-13-8-12-10-5-4-9(2)7-11(10)13/h3-4,7-8,10H,1,5-6H2,2H3.
What are the key properties of 6-methyl-1-prop-2-enyl-3a,4-dihydrobenzimidazole?
6-methyl-1-prop-2-enyl-3a,4-dihydrobenzimidazole has a molecular weight of 174.25 g/mol, XLogP of 2.12, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-1-prop-2-enyl-3a,4-dihydrobenzimidazole is sourced from PubChem (CID 146593647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).